C25H26F3N5O4S — CID 151153952
benzyl N-[(1S,3S,5R)-3-(2-oxoethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 151153952) has the molecular formula C25H26F3N5O4S and a molecular weight of 549.58 g/mol. Its IUPAC name is benzyl N-[(1S,3S,5R)-3-(2-oxoethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,3S,5R)-3-(2-oxoethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 151153952 |
| Molecular Formula | C25H26F3N5O4S |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | benzyl N-[(1S,3S,5R)-3-(2-oxoethylcarbamoyl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | O=CCNC(=O)[C@@H]1C[C@H](NC(=O)OCc2ccccc2)C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C25H26F3N5O4S/c26-25(27,28)12-19-11-20-21(30-14-31-23(20)38-19)32-17-8-16(22(35)29-6-7-34)9-18(10-17)33-24(36)37-13-15-4-2-1-3-5-15/h1-5,7,11,14,16-18H,6,8-10,12-13H2,(H,29,35)(H,33,36)(H,30,31,32)/t16-,17+,18-/m0/s1 |
| InChIKey | MYUWYNJSPVUBBL-KSZLIROESA-N |
| XLogP | 3.99 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|