About 3-benzamidobutyl benzoate
3-benzamidobutyl benzoate (PubChem CID 151154190) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 3-benzamidobutyl benzoate.
Molecular Properties
| Compound Name | 3-benzamidobutyl benzoate |
| PubChem CID | 151154190 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-benzamidobutyl benzoate |
| SMILES | CC(CCOC(=O)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-14(19-17(20)15-8-4-2-5-9-15)12-13-22-18(21)16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H,19,20) |
| InChIKey | MYWISEWWHMINES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzamidobutyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzamidobutyl benzoate?
The IUPAC name of 3-benzamidobutyl benzoate (CID 151154190) is 3-benzamidobutyl benzoate.
What is the SMILES notation for 3-benzamidobutyl benzoate?
The canonical SMILES for 3-benzamidobutyl benzoate is CC(CCOC(=O)c1ccccc1)NC(=O)c1ccccc1.
What is the InChIKey of 3-benzamidobutyl benzoate?
The InChIKey is MYWISEWWHMINES-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-14(19-17(20)15-8-4-2-5-9-15)12-13-22-18(21)16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H,19,20).
What are the key properties of 3-benzamidobutyl benzoate?
3-benzamidobutyl benzoate has a molecular weight of 297.35 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzamidobutyl benzoate is sourced from PubChem (CID 151154190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).