C22H12FN3O2 — CID 151156115
2-[(4-fluorophenyl)methoxy]-16-oxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaene-7-carbonitrile (PubChem CID 151156115) has the molecular formula C22H12FN3O2 and a molecular weight of 369.36 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methoxy]-16-oxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaene-7-carbonitrile.
| Compound Name | 2-[(4-fluorophenyl)methoxy]-16-oxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaene-7-carbonitrile |
|---|---|
| PubChem CID | 151156115 |
| Molecular Formula | C22H12FN3O2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-[(4-fluorophenyl)methoxy]-16-oxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaene-7-carbonitrile |
| SMILES | N#Cc1cccc2c(OCc3ccc(F)cc3)c3c(nc12)-c1cccn1C3=O |
| InChI | InChI=1S/C22H12FN3O2/c23-15-8-6-13(7-9-15)12-28-21-16-4-1-3-14(11-24)19(16)25-20-17-5-2-10-26(17)22(27)18(20)21/h1-10H,12H2 |
| InChIKey | MZGVPPVUNJYQSV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |