C32H32N4O11S3 — CID 15115671
[(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 15115671) has the molecular formula C32H32N4O11S3 and a molecular weight of 744.83 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15115671 |
| Molecular Formula | C32H32N4O11S3 |
| Molecular Weight | 744.83 g/mol |
| Exact Mass | 744.12 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(6-methoxypurin-9-yl)-3,4-bis-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H32N4O11S3/c1-20-5-11-23(12-6-20)48(37,38)44-17-26-28(46-49(39,40)24-13-7-21(2)8-14-24)29(47-50(41,42)25-15-9-22(3)10-16-25)32(45-26)36-19-35-27-30(36)33-18-34-31(27)43-4/h5-16,18-19,26,28-29,32H,17H2,1-4H3/t26-,28-,29+,32-/m1/s1 |
| InChIKey | YIZOPIMWWFTUND-NFFKMHHLSA-N |
| XLogP | 3.61 |
| TPSA | 192.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|