About [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate
[5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate (PubChem CID 151159271) has the molecular formula C14H11F7N2O3S
and a molecular weight of 420.31 g/mol. Its IUPAC name is [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate |
| PubChem CID | 151159271 |
| Molecular Formula | C14H11F7N2O3S |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate |
| SMILES | Cc1c(Cc2cc(F)cc(C(F)(F)F)c2)nn(C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H11F7N2O3S/c1-7-11(5-8-3-9(13(16,17)18)6-10(15)4-8)22-23(2)12(7)26-27(24,25)14(19,20)21/h3-4,6H,5H2,1-2H3 |
| InChIKey | MZXJYHADQKOUKF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate?
The IUPAC name of [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate (CID 151159271) is [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate?
The canonical SMILES for [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate is Cc1c(Cc2cc(F)cc(C(F)(F)F)c2)nn(C)c1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate?
The InChIKey is MZXJYHADQKOUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F7N2O3S/c1-7-11(5-8-3-9(13(16,17)18)6-10(15)4-8)22-23(2)12(7)26-27(24,25)14(19,20)21/h3-4,6H,5H2,1-2H3.
What are the key properties of [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate?
[5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate has a molecular weight of 420.31 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2,4-dimethylpyrazol-3-yl] trifluoromethanesulfonate is sourced from PubChem (CID 151159271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).