C8H10Cl3N5O3S — CID 151161004
1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1-(1,2,2-trichloroethylsulfonyl)urea (PubChem CID 151161004) has the molecular formula C8H10Cl3N5O3S and a molecular weight of 362.63 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1-(1,2,2-trichloroethylsulfonyl)urea.
| Compound Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1-(1,2,2-trichloroethylsulfonyl)urea |
|---|---|
| PubChem CID | 151161004 |
| Molecular Formula | C8H10Cl3N5O3S |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 1-(5,6-dimethyl-1,2,4-triazin-3-yl)-1-(1,2,2-trichloroethylsulfonyl)urea |
| SMILES | Cc1nnc(N(C(N)=O)S(=O)(=O)C(Cl)C(Cl)Cl)nc1C |
| InChI | InChI=1S/C8H10Cl3N5O3S/c1-3-4(2)14-15-8(13-3)16(7(12)17)20(18,19)6(11)5(9)10/h5-6H,1-2H3,(H2,12,17) |
| InChIKey | NAGLLTZDWGMCMQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|