C18H18ClNO7 — CID 15116761
[4-(4-chloro-2-nitrobenzoyl)-2,2,6,6-tetramethyl-5-oxopyran-3-yl] acetate (PubChem CID 15116761) has the molecular formula C18H18ClNO7 and a molecular weight of 395.80 g/mol. Its IUPAC name is [4-(4-chloro-2-nitrobenzoyl)-2,2,6,6-tetramethyl-5-oxopyran-3-yl] acetate.
| Compound Name | [4-(4-chloro-2-nitrobenzoyl)-2,2,6,6-tetramethyl-5-oxopyran-3-yl] acetate |
|---|---|
| PubChem CID | 15116761 |
| Molecular Formula | C18H18ClNO7 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [4-(4-chloro-2-nitrobenzoyl)-2,2,6,6-tetramethyl-5-oxopyran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C(=O)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C18H18ClNO7/c1-9(21)26-16-13(15(23)17(2,3)27-18(16,4)5)14(22)11-7-6-10(19)8-12(11)20(24)25/h6-8H,1-5H3 |
| InChIKey | GRZXLHDBSDFNHH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|