C34H48N2O6S4 — CID 151169815
3,4,5-triethoxy-2-[3-[3-(3,4,5-triethoxy-1H-indol-2-yl)propyltetrasulfanyl]propyl]-1H-indole (PubChem CID 151169815) has the molecular formula C34H48N2O6S4 and a molecular weight of 709.03 g/mol. Its IUPAC name is 3,4,5-triethoxy-2-[3-[3-(3,4,5-triethoxy-1H-indol-2-yl)propyltetrasulfanyl]propyl]-1H-indole.
| Compound Name | 3,4,5-triethoxy-2-[3-[3-(3,4,5-triethoxy-1H-indol-2-yl)propyltetrasulfanyl]propyl]-1H-indole |
|---|---|
| PubChem CID | 151169815 |
| Molecular Formula | C34H48N2O6S4 |
| Molecular Weight | 709.03 g/mol |
| Exact Mass | 708.24 |
| IUPAC Name | 3,4,5-triethoxy-2-[3-[3-(3,4,5-triethoxy-1H-indol-2-yl)propyltetrasulfanyl]propyl]-1H-indole |
| SMILES | CCOc1ccc2[nH]c(CCCSSSSCCCc3[nH]c4ccc(OCC)c(OCC)c4c3OCC)c(OCC)c2c1OCC |
| InChI | InChI=1S/C34H48N2O6S4/c1-7-37-27-19-17-23-29(33(27)41-11-5)31(39-9-3)25(35-23)15-13-21-43-45-46-44-22-14-16-26-32(40-10-4)30-24(36-26)18-20-28(38-8-2)34(30)42-12-6/h17-20,35-36H,7-16,21-22H2,1-6H3 |
| InChIKey | NCAOTRGUVQWROA-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.03 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|