C25H24F6N2O3 — CID 151171409
9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-5-(2,3,5-trifluorophenyl)-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 151171409) has the molecular formula C25H24F6N2O3 and a molecular weight of 514.47 g/mol. Its IUPAC name is 9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-5-(2,3,5-trifluorophenyl)-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | 9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-5-(2,3,5-trifluorophenyl)-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 151171409 |
| Molecular Formula | C25H24F6N2O3 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-5-(2,3,5-trifluorophenyl)-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | CO[C@@](C(=O)N1CCC2(CC1)CC(=O)NCC2c1cc(F)cc(F)c1F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H24F6N2O3/c1-36-24(25(29,30)31,15-5-3-2-4-6-15)22(35)33-9-7-23(8-10-33)13-20(34)32-14-18(23)17-11-16(26)12-19(27)21(17)28/h2-6,11-12,18H,7-10,13-14H2,1H3,(H,32,34)/t18?,24-/m1/s1 |
| InChIKey | NCIYFSYMYBVHAS-VCUSLETLSA-N |
| XLogP | 4.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|