C22H36N2O5Si — CID 15117226
prop-2-enyl 5-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 15117226) has the molecular formula C22H36N2O5Si and a molecular weight of 436.63 g/mol. Its IUPAC name is prop-2-enyl 5-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | prop-2-enyl 5-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 15117226 |
| Molecular Formula | C22H36N2O5Si |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | prop-2-enyl 5-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC=C(C(=O)C[C@H]2NC(=O)[C@@H]2[C@@H](C)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C22H36N2O5Si/c1-8-12-28-21(27)24-11-9-10-16(14-24)18(25)13-17-19(20(26)23-17)15(2)29-30(6,7)22(3,4)5/h8,10,15,17,19H,1,9,11-14H2,2-7H3,(H,23,26)/t15-,17-,19-/m1/s1 |
| InChIKey | PXZBWGMYAOYBJM-SZVBFZGTSA-N |
| XLogP | 3.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|