C21H35FN2O5Si — CID 15117270
prop-2-enyl (2S)-2-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 15117270) has the molecular formula C21H35FN2O5Si and a molecular weight of 442.60 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S)-2-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15117270 |
| Molecular Formula | C21H35FN2O5Si |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | prop-2-enyl (2S)-2-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(F)C[C@H]1C(=O)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H35FN2O5Si/c1-8-9-28-20(27)24-12-14(22)10-16(24)17(25)11-15-18(19(26)23-15)13(2)29-30(6,7)21(3,4)5/h8,13-16,18H,1,9-12H2,2-7H3,(H,23,26)/t13-,14?,15-,16+,18-/m1/s1 |
| InChIKey | MIMLMGWQKABXED-RNIUXLFRSA-N |
| XLogP | 3.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|