C15H19NO7S — CID 15117279
prop-2-enyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)thiomorpholine-4-carboxylate (PubChem CID 15117279) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is prop-2-enyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)thiomorpholine-4-carboxylate.
| Compound Name | prop-2-enyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)thiomorpholine-4-carboxylate |
|---|---|
| PubChem CID | 15117279 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | prop-2-enyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)thiomorpholine-4-carboxylate |
| SMILES | C=CCOC(=O)N1CCSCC1C(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C15H19NO7S/c1-4-6-21-14(20)16-5-7-24-8-9(16)11(17)10-12(18)22-15(2,3)23-13(10)19/h4,9-10H,1,5-8H2,2-3H3 |
| InChIKey | LXVLBMDGPWQLEC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|