C26H35FN6O2Si — CID 151174811
N-[6-[4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]-6-fluoro-1,2,3,4-tetrahydroisoquinoline-7-carboxamide (PubChem CID 151174811) has the molecular formula C26H35FN6O2Si and a molecular weight of 510.69 g/mol. Its IUPAC name is N-[6-[4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]-6-fluoro-1,2,3,4-tetrahydroisoquinoline-7-carboxamide.
| Compound Name | N-[6-[4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]-6-fluoro-1,2,3,4-tetrahydroisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 151174811 |
| Molecular Formula | C26H35FN6O2Si |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | N-[6-[4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-1,2,4-triazol-3-yl]-2-pyridinyl]-6-fluoro-1,2,3,4-tetrahydroisoquinoline-7-carboxamide |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)n1cnnc1-c1cccc(NC(=O)c2cc3c(cc2F)CCNC3)n1 |
| InChI | InChI=1S/C26H35FN6O2Si/c1-17(15-35-36(5,6)26(2,3)4)33-16-29-32-24(33)22-8-7-9-23(30-22)31-25(34)20-12-19-14-28-11-10-18(19)13-21(20)27/h7-9,12-13,16-17,28H,10-11,14-15H2,1-6H3,(H,30,31,34)/t17-/m1/s1 |
| InChIKey | NDASZZGDCXTPGQ-QGZVFWFLSA-N |
| XLogP | 4.96 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|