C14H18N2 — CID 151175041
2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-1-yl)ethanamine (PubChem CID 151175041) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-1-yl)ethanamine.
| Compound Name | 2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-1-yl)ethanamine |
|---|---|
| PubChem CID | 151175041 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-(6,7,8,9-tetrahydropyrido[1,2-a]indol-1-yl)ethanamine |
| SMILES | NCCc1cccc2c1cc1n2CCCC1 |
| InChI | InChI=1S/C14H18N2/c15-8-7-11-4-3-6-14-13(11)10-12-5-1-2-9-16(12)14/h3-4,6,10H,1-2,5,7-9,15H2 |
| InChIKey | NDCBLEYLWRDHSO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|