C15H11N3 — CID 151175251
13,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,10,12,14,16-octaen-12-amine (PubChem CID 151175251) has the molecular formula C15H11N3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 13,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,10,12,14,16-octaen-12-amine.
| Compound Name | 13,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,10,12,14,16-octaen-12-amine |
|---|---|
| PubChem CID | 151175251 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 13,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,4,6,8,10,12,14,16-octaen-12-amine |
| SMILES | Nc1nccc2c1=c1ccc3c(c1N=2)CC=CC=3 |
| InChI | InChI=1S/C15H11N3/c16-15-13-11-6-5-9-3-1-2-4-10(9)14(11)18-12(13)7-8-17-15/h1-3,5-8H,4H2,(H2,16,17) |
| InChIKey | NDDCORYMPXXVNP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |