C41H46OSi — CID 151176152
cyclopenta-2,4-dien-1-yl-(2,7-ditert-butyl-4-methoxy-9H-fluoren-1-yl)-bis(4-methylphenyl)silane (PubChem CID 151176152) has the molecular formula C41H46OSi and a molecular weight of 582.90 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-(2,7-ditert-butyl-4-methoxy-9H-fluoren-1-yl)-bis(4-methylphenyl)silane.
| Compound Name | cyclopenta-2,4-dien-1-yl-(2,7-ditert-butyl-4-methoxy-9H-fluoren-1-yl)-bis(4-methylphenyl)silane |
|---|---|
| PubChem CID | 151176152 |
| Molecular Formula | C41H46OSi |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-(2,7-ditert-butyl-4-methoxy-9H-fluoren-1-yl)-bis(4-methylphenyl)silane |
| SMILES | COc1cc(C(C)(C)C)c([Si](c2ccc(C)cc2)(c2ccc(C)cc2)C2C=CC=C2)c2c1-c1ccc(C(C)(C)C)cc1C2 |
| InChI | InChI=1S/C41H46OSi/c1-27-14-19-32(20-15-27)43(31-12-10-11-13-31,33-21-16-28(2)17-22-33)39-35-25-29-24-30(40(3,4)5)18-23-34(29)38(35)37(42-9)26-36(39)41(6,7)8/h10-24,26,31H,25H2,1-9H3 |
| InChIKey | NDHOIVJLDLGTJC-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|