C8H11F3N2O5S — CID 151177547
[(2S,5R)-7-oxo-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 151177547) has the molecular formula C8H11F3N2O5S and a molecular weight of 304.25 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 151177547 |
| Molecular Formula | C8H11F3N2O5S |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [(2S,5R)-7-oxo-2-(2,2,2-trifluoroethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C1N2C[C@@H](CC[C@H]2CC(F)(F)F)N1OS(=O)(=O)O |
| InChI | InChI=1S/C8H11F3N2O5S/c9-8(10,11)3-5-1-2-6-4-12(5)7(14)13(6)18-19(15,16)17/h5-6H,1-4H2,(H,15,16,17)/t5-,6+/m0/s1 |
| InChIKey | NDOVHCLIEOSYIJ-NTSWFWBYSA-N |
| XLogP | 0.94 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|