C14H18N2O2 — CID 151179103
1-benzyl-4a,5,6,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazin-2-one (PubChem CID 151179103) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-benzyl-4a,5,6,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazin-2-one.
| Compound Name | 1-benzyl-4a,5,6,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 151179103 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-benzyl-4a,5,6,7,8,8a-hexahydropyrido[3,4-b][1,4]oxazin-2-one |
| SMILES | O=C1COC2CNCCC2N1Cc1ccccc1 |
| InChI | InChI=1S/C14H18N2O2/c17-14-10-18-13-8-15-7-6-12(13)16(14)9-11-4-2-1-3-5-11/h1-5,12-13,15H,6-10H2 |
| InChIKey | NDXILLOSFDZUCX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |