C13H14N4O — CID 151180497
1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,5,7,10,12-pentaene-4-carboxamide (PubChem CID 151180497) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,5,7,10,12-pentaene-4-carboxamide.
| Compound Name | 1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,5,7,10,12-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 151180497 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,5,7,10,12-pentaene-4-carboxamide |
| SMILES | NC(=O)C1=CN2C(=CN3C=CC=CCN2C3)C=C1 |
| InChI | InChI=1S/C13H14N4O/c14-13(18)11-4-5-12-9-15-6-2-1-3-7-16(10-15)17(12)8-11/h1-6,8-9H,7,10H2,(H2,14,18) |
| InChIKey | NEEOUOUZIZPAJW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |