About ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate
ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate (PubChem CID 15118110) has the molecular formula C14H15F6NO4S
and a molecular weight of 407.33 g/mol. Its IUPAC name is ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate |
| PubChem CID | 15118110 |
| Molecular Formula | C14H15F6NO4S |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)S(=O)(=O)Cc1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F6NO4S/c1-3-25-12(22)7-21(2)26(23,24)8-9-4-5-10(13(15,16)17)11(6-9)14(18,19)20/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | GCYBWJTUHCXXOF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate?
The IUPAC name of ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate (CID 15118110) is ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate.
What is the SMILES notation for ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate?
The canonical SMILES for ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate is CCOC(=O)CN(C)S(=O)(=O)Cc1ccc(C(F)(F)F)c(C(F)(F)F)c1.
What is the InChIKey of ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate?
The InChIKey is GCYBWJTUHCXXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F6NO4S/c1-3-25-12(22)7-21(2)26(23,24)8-9-4-5-10(13(15,16)17)11(6-9)14(18,19)20/h4-6H,3,7-8H2,1-2H3.
What are the key properties of ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate?
ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate has a molecular weight of 407.33 g/mol, XLogP of 3.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[3,4-bis(trifluoromethyl)phenyl]methylsulfonyl-methylamino]acetate is sourced from PubChem (CID 15118110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).