About 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide
2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide (PubChem CID 15118139) has the molecular formula C12H14ClF3N2O3S
and a molecular weight of 358.77 g/mol. Its IUPAC name is 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide |
| PubChem CID | 15118139 |
| Molecular Formula | C12H14ClF3N2O3S |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)S(=O)(=O)Cc1ccc(C(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O3S/c1-18(5-10(17)19)22(20,21)6-8-3-2-7(4-9(8)13)11(14)12(15)16/h2-4,11-12H,5-6H2,1H3,(H2,17,19) |
| InChIKey | XRUUQUOWCGXQJG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide?
The IUPAC name of 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide (CID 15118139) is 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide.
What is the SMILES notation for 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide?
The canonical SMILES for 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide is CN(CC(N)=O)S(=O)(=O)Cc1ccc(C(F)C(F)F)cc1Cl.
What is the InChIKey of 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide?
The InChIKey is XRUUQUOWCGXQJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClF3N2O3S/c1-18(5-10(17)19)22(20,21)6-8-3-2-7(4-9(8)13)11(14)12(15)16/h2-4,11-12H,5-6H2,1H3,(H2,17,19).
What are the key properties of 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide?
2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide has a molecular weight of 358.77 g/mol, XLogP of 1.86, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-methylamino]acetamide is sourced from PubChem (CID 15118139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).