C14H16ClF3N2O3S — CID 15118161
2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-prop-2-enylamino]acetamide (PubChem CID 15118161) has the molecular formula C14H16ClF3N2O3S and a molecular weight of 384.81 g/mol. Its IUPAC name is 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-prop-2-enylamino]acetamide.
| Compound Name | 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-prop-2-enylamino]acetamide |
|---|---|
| PubChem CID | 15118161 |
| Molecular Formula | C14H16ClF3N2O3S |
| Molecular Weight | 384.81 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-[[2-chloro-4-(1,2,2-trifluoroethyl)phenyl]methylsulfonyl-prop-2-enylamino]acetamide |
| SMILES | C=CCN(CC(N)=O)S(=O)(=O)Cc1ccc(C(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C14H16ClF3N2O3S/c1-2-5-20(7-12(19)21)24(22,23)8-10-4-3-9(6-11(10)15)13(16)14(17)18/h2-4,6,13-14H,1,5,7-8H2,(H2,19,21) |
| InChIKey | AUVBIHJMJOXHTR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|