About 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline
7-bromo-4,4-difluoro-3,3-dimethylisoquinoline (PubChem CID 151183022) has the molecular formula C11H10BrF2N
and a molecular weight of 274.11 g/mol. Its IUPAC name is 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline.
Molecular Properties
| Compound Name | 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline |
| PubChem CID | 151183022 |
| Molecular Formula | C11H10BrF2N |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline |
| SMILES | CC1(C)N=Cc2cc(Br)ccc2C1(F)F |
| InChI | InChI=1S/C11H10BrF2N/c1-10(2)11(13,14)9-4-3-8(12)5-7(9)6-15-10/h3-6H,1-2H3 |
| InChIKey | NERXXHDYNPFFBF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline?
The IUPAC name of 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline (CID 151183022) is 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline.
What is the SMILES notation for 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline?
The canonical SMILES for 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline is CC1(C)N=Cc2cc(Br)ccc2C1(F)F.
What is the InChIKey of 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline?
The InChIKey is NERXXHDYNPFFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF2N/c1-10(2)11(13,14)9-4-3-8(12)5-7(9)6-15-10/h3-6H,1-2H3.
What are the key properties of 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline?
7-bromo-4,4-difluoro-3,3-dimethylisoquinoline has a molecular weight of 274.11 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4,4-difluoro-3,3-dimethylisoquinoline is sourced from PubChem (CID 151183022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).