C9H11F5O2 — CID 151187676
3-(1,1,2,2,2-pentafluoroethyl)-2-(prop-1-enoxymethyl)oxetane (PubChem CID 151187676) has the molecular formula C9H11F5O2 and a molecular weight of 246.17 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-2-(prop-1-enoxymethyl)oxetane.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-2-(prop-1-enoxymethyl)oxetane |
|---|---|
| PubChem CID | 151187676 |
| Molecular Formula | C9H11F5O2 |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-2-(prop-1-enoxymethyl)oxetane |
| SMILES | CC=COCC1OCC1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F5O2/c1-2-3-15-5-7-6(4-16-7)8(10,11)9(12,13)14/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | NFQPLQHHSCBIAM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|