C18H23ClO4 — CID 15118802
(1S,2S,3S,7S,10S,11R,12R,16S)-8-chloro-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene (PubChem CID 15118802) has the molecular formula C18H23ClO4 and a molecular weight of 338.83 g/mol. Its IUPAC name is (1S,2S,3S,7S,10S,11R,12R,16S)-8-chloro-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene.
| Compound Name | (1S,2S,3S,7S,10S,11R,12R,16S)-8-chloro-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene |
|---|---|
| PubChem CID | 15118802 |
| Molecular Formula | C18H23ClO4 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (1S,2S,3S,7S,10S,11R,12R,16S)-8-chloro-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C=C[C@H]([C@@H]2O1)[C@@H]1[C@H]3C=C(Cl)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H23ClO4/c1-17(2)20-13-8-5-6-9(14(13)21-17)12-10(8)7-11(19)15-16(12)23-18(3,4)22-15/h5-10,12-16H,1-4H3/t8-,9+,10+,12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | HAPJTGIDNDBLGP-CIGAOCKZSA-N |
| XLogP | 3.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|