C17H17ClFN5O4 — CID 151188558
(2S,3R,4S,5R)-2-[2-chloro-6-(phenylmethoxyamino)purin-9-yl]-2-fluoro-5-methyloxolane-3,4-diol (PubChem CID 151188558) has the molecular formula C17H17ClFN5O4 and a molecular weight of 409.81 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-[2-chloro-6-(phenylmethoxyamino)purin-9-yl]-2-fluoro-5-methyloxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-[2-chloro-6-(phenylmethoxyamino)purin-9-yl]-2-fluoro-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 151188558 |
| Molecular Formula | C17H17ClFN5O4 |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (2S,3R,4S,5R)-2-[2-chloro-6-(phenylmethoxyamino)purin-9-yl]-2-fluoro-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@](F)(n2cnc3c(NOCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H17ClFN5O4/c1-9-12(25)13(26)17(19,28-9)24-8-20-11-14(21-16(18)22-15(11)24)23-27-7-10-5-3-2-4-6-10/h2-6,8-9,12-13,25-26H,7H2,1H3,(H,21,22,23)/t9-,12-,13-,17+/m1/s1 |
| InChIKey | NFVCSFPOYUNGMX-HYNLGEKVSA-N |
| XLogP | 1.74 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|