About CID 151188564
CID 151188564 (PubChem CID 151188564) has the molecular formula C17H20FNO2Si
and a molecular weight of 317.44 g/mol.
Molecular Properties
| Compound Name | CID 151188564 |
| PubChem CID | 151188564 |
| Molecular Formula | C17H20FNO2Si |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | — |
| SMILES | CCN(CC)[Si]OCOc1ccc(-c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H20FNO2Si/c1-3-19(4-2)22-21-13-20-17-10-8-14(9-11-17)15-6-5-7-16(18)12-15/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | KHBSMGCHRCNJQO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 151188564 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 151188564?
The IUPAC name of CID 151188564 (CID 151188564) is not available.
What is the SMILES notation for CID 151188564?
The canonical SMILES for CID 151188564 is CCN(CC)[Si]OCOc1ccc(-c2cccc(F)c2)cc1.
What is the InChIKey of CID 151188564?
The InChIKey is KHBSMGCHRCNJQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FNO2Si/c1-3-19(4-2)22-21-13-20-17-10-8-14(9-11-17)15-6-5-7-16(18)12-15/h5-12H,3-4,13H2,1-2H3.
What are the key properties of CID 151188564?
CID 151188564 has a molecular weight of 317.44 g/mol, XLogP of 3.72, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 151188564 is sourced from PubChem (CID 151188564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).