C26H37N3O2 — CID 15118930
(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-1-[2-[(3-phenylpropylamino)methyl]piperidin-1-yl]propan-1-one (PubChem CID 15118930) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-1-[2-[(3-phenylpropylamino)methyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-1-[2-[(3-phenylpropylamino)methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 15118930 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-1-[2-[(3-phenylpropylamino)methyl]piperidin-1-yl]propan-1-one |
| SMILES | Cc1cc(O)cc(C)c1C[C@H](N)C(=O)N1CCCCC1CNCCCc1ccccc1 |
| InChI | InChI=1S/C26H37N3O2/c1-19-15-23(30)16-20(2)24(19)17-25(27)26(31)29-14-7-6-12-22(29)18-28-13-8-11-21-9-4-3-5-10-21/h3-5,9-10,15-16,22,25,28,30H,6-8,11-14,17-18,27H2,1-2H3/t22?,25-/m0/s1 |
| InChIKey | VUAONNNCJVHIBJ-TUXUZCGSSA-N |
| XLogP | 3.48 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|