About 2-(azidomethyl)-1,3,5-trichlorobenzene
2-(azidomethyl)-1,3,5-trichlorobenzene (PubChem CID 151190650) has the molecular formula C7H4Cl3N3
and a molecular weight of 236.49 g/mol. Its IUPAC name is 2-(azidomethyl)-1,3,5-trichlorobenzene.
Molecular Properties
| Compound Name | 2-(azidomethyl)-1,3,5-trichlorobenzene |
| PubChem CID | 151190650 |
| Molecular Formula | C7H4Cl3N3 |
| Molecular Weight | 236.49 g/mol |
| Exact Mass | 234.95 |
| IUPAC Name | 2-(azidomethyl)-1,3,5-trichlorobenzene |
| SMILES | [N-]=[N+]=NCc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl3N3/c8-4-1-6(9)5(3-12-13-11)7(10)2-4/h1-2H,3H2 |
| InChIKey | NGGACUURUOOCMH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(azidomethyl)-1,3,5-trichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azidomethyl)-1,3,5-trichlorobenzene?
The IUPAC name of 2-(azidomethyl)-1,3,5-trichlorobenzene (CID 151190650) is 2-(azidomethyl)-1,3,5-trichlorobenzene.
What is the SMILES notation for 2-(azidomethyl)-1,3,5-trichlorobenzene?
The canonical SMILES for 2-(azidomethyl)-1,3,5-trichlorobenzene is [N-]=[N+]=NCc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2-(azidomethyl)-1,3,5-trichlorobenzene?
The InChIKey is NGGACUURUOOCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl3N3/c8-4-1-6(9)5(3-12-13-11)7(10)2-4/h1-2H,3H2.
What are the key properties of 2-(azidomethyl)-1,3,5-trichlorobenzene?
2-(azidomethyl)-1,3,5-trichlorobenzene has a molecular weight of 236.49 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)-1,3,5-trichlorobenzene is sourced from PubChem (CID 151190650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).