C11H17N3O2 — CID 151195468
(1S,2R,3R,5R)-3-ethyl-5-(pyrimidin-4-ylamino)cyclopentane-1,2-diol (PubChem CID 151195468) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-ethyl-5-(pyrimidin-4-ylamino)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-ethyl-5-(pyrimidin-4-ylamino)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 151195468 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | (1S,2R,3R,5R)-3-ethyl-5-(pyrimidin-4-ylamino)cyclopentane-1,2-diol |
| SMILES | CC[C@@H]1C[C@@H](Nc2ccncn2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H17N3O2/c1-2-7-5-8(11(16)10(7)15)14-9-3-4-12-6-13-9/h3-4,6-8,10-11,15-16H,2,5H2,1H3,(H,12,13,14)/t7-,8-,10-,11+/m1/s1 |
| InChIKey | NHFAZLWLWLYPRG-OYBPUVFXSA-N |
| XLogP | 0.41 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |