C24H28N6O4S2 — CID 151195996
[4-[6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]imidazo[2,1-b][1,3]benzothiazol-2-yl]phenyl]urea (PubChem CID 151195996) has the molecular formula C24H28N6O4S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is [4-[6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]imidazo[2,1-b][1,3]benzothiazol-2-yl]phenyl]urea.
| Compound Name | [4-[6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]imidazo[2,1-b][1,3]benzothiazol-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 151195996 |
| Molecular Formula | C24H28N6O4S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | [4-[6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]imidazo[2,1-b][1,3]benzothiazol-2-yl]phenyl]urea |
| SMILES | CS(=O)(=O)N1CCN(CCCOc2ccc3c(c2)sc2nc(-c4ccc(NC(N)=O)cc4)cn23)CC1 |
| InChI | InChI=1S/C24H28N6O4S2/c1-36(32,33)29-12-10-28(11-13-29)9-2-14-34-19-7-8-21-22(15-19)35-24-27-20(16-30(21)24)17-3-5-18(6-4-17)26-23(25)31/h3-8,15-16H,2,9-14H2,1H3,(H3,25,26,31) |
| InChIKey | NHHVKJPOFYFNEL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|