About methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate
methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate (PubChem CID 15119899) has the molecular formula C12H13NO4
and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate |
| PubChem CID | 15119899 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate |
| SMILES | COC(=O)C1CCc2c(C(C)=O)ccc(=O)n21 |
| InChI | InChI=1S/C12H13NO4/c1-7(14)8-3-6-11(15)13-9(8)4-5-10(13)12(16)17-2/h3,6,10H,4-5H2,1-2H3 |
| InChIKey | UCAFTRKPFMKCSO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The IUPAC name of methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate (CID 15119899) is methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate.
What is the SMILES notation for methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The canonical SMILES for methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate is COC(=O)C1CCc2c(C(C)=O)ccc(=O)n21.
What is the InChIKey of methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
The InChIKey is UCAFTRKPFMKCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c1-7(14)8-3-6-11(15)13-9(8)4-5-10(13)12(16)17-2/h3,6,10H,4-5H2,1-2H3.
What are the key properties of methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate?
methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate has a molecular weight of 235.24 g/mol, XLogP of 0.71, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate is sourced from PubChem (CID 15119899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).