About 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole
1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole (PubChem CID 151199471) has the molecular formula C18H21N3O2S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole |
| PubChem CID | 151199471 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole |
| SMILES | O=S(=O)(c1ccccc1)N1CCc2cc(N3CCNCC3)ccc21 |
| InChI | InChI=1S/C18H21N3O2S/c22-24(23,17-4-2-1-3-5-17)21-11-8-15-14-16(6-7-18(15)21)20-12-9-19-10-13-20/h1-7,14,19H,8-13H2 |
| InChIKey | NIACINIBVJMBGI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole?
The IUPAC name of 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole (CID 151199471) is 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole.
What is the SMILES notation for 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole?
The canonical SMILES for 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole is O=S(=O)(c1ccccc1)N1CCc2cc(N3CCNCC3)ccc21.
What is the InChIKey of 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole?
The InChIKey is NIACINIBVJMBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2S/c22-24(23,17-4-2-1-3-5-17)21-11-8-15-14-16(6-7-18(15)21)20-12-9-19-10-13-20/h1-7,14,19H,8-13H2.
What are the key properties of 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole?
1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole has a molecular weight of 343.45 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-5-piperazin-1-yl-2,3-dihydroindole is sourced from PubChem (CID 151199471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).