About 1-bromo-5,5-dimethylimidazolidine
1-bromo-5,5-dimethylimidazolidine (PubChem CID 151201573) has the molecular formula C5H11BrN2
and a molecular weight of 179.06 g/mol. Its IUPAC name is 1-bromo-5,5-dimethylimidazolidine.
Molecular Properties
| Compound Name | 1-bromo-5,5-dimethylimidazolidine |
| PubChem CID | 151201573 |
| Molecular Formula | C5H11BrN2 |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | 1-bromo-5,5-dimethylimidazolidine |
| SMILES | CC1(C)CNCN1Br |
| InChI | InChI=1S/C5H11BrN2/c1-5(2)3-7-4-8(5)6/h7H,3-4H2,1-2H3 |
| InChIKey | NIKMKJWVWJONDY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5,5-dimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,5-dimethylimidazolidine?
The IUPAC name of 1-bromo-5,5-dimethylimidazolidine (CID 151201573) is 1-bromo-5,5-dimethylimidazolidine.
What is the SMILES notation for 1-bromo-5,5-dimethylimidazolidine?
The canonical SMILES for 1-bromo-5,5-dimethylimidazolidine is CC1(C)CNCN1Br.
What is the InChIKey of 1-bromo-5,5-dimethylimidazolidine?
The InChIKey is NIKMKJWVWJONDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11BrN2/c1-5(2)3-7-4-8(5)6/h7H,3-4H2,1-2H3.
What are the key properties of 1-bromo-5,5-dimethylimidazolidine?
1-bromo-5,5-dimethylimidazolidine has a molecular weight of 179.06 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,5-dimethylimidazolidine is sourced from PubChem (CID 151201573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).