About 3H-pyrrolo[2,3-b]pyridin-2-amine
3H-pyrrolo[2,3-b]pyridin-2-amine (PubChem CID 151203148) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 3H-pyrrolo[2,3-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 3H-pyrrolo[2,3-b]pyridin-2-amine |
| PubChem CID | 151203148 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 3H-pyrrolo[2,3-b]pyridin-2-amine |
| SMILES | NC1=Nc2ncccc2C1 |
| InChI | InChI=1S/C7H7N3/c8-6-4-5-2-1-3-9-7(5)10-6/h1-3H,4H2,(H2,8,9,10) |
| InChIKey | NISKWTRYYIFZOH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-pyrrolo[2,3-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrolo[2,3-b]pyridin-2-amine?
The IUPAC name of 3H-pyrrolo[2,3-b]pyridin-2-amine (CID 151203148) is 3H-pyrrolo[2,3-b]pyridin-2-amine.
What is the SMILES notation for 3H-pyrrolo[2,3-b]pyridin-2-amine?
The canonical SMILES for 3H-pyrrolo[2,3-b]pyridin-2-amine is NC1=Nc2ncccc2C1.
What is the InChIKey of 3H-pyrrolo[2,3-b]pyridin-2-amine?
The InChIKey is NISKWTRYYIFZOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c8-6-4-5-2-1-3-9-7(5)10-6/h1-3H,4H2,(H2,8,9,10).
What are the key properties of 3H-pyrrolo[2,3-b]pyridin-2-amine?
3H-pyrrolo[2,3-b]pyridin-2-amine has a molecular weight of 133.15 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrolo[2,3-b]pyridin-2-amine is sourced from PubChem (CID 151203148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).