About 2-chloro-2-methyloxirane
2-chloro-2-methyloxirane (PubChem CID 15120421) has the molecular formula C3H5ClO
and a molecular weight of 92.53 g/mol. Its IUPAC name is 2-chloro-2-methyloxirane.
Molecular Properties
| Compound Name | 2-chloro-2-methyloxirane |
| PubChem CID | 15120421 |
| Molecular Formula | C3H5ClO |
| Molecular Weight | 92.53 g/mol |
| Exact Mass | 92.00 |
| IUPAC Name | 2-chloro-2-methyloxirane |
| SMILES | CC1(Cl)CO1 |
| InChI | InChI=1S/C3H5ClO/c1-3(4)2-5-3/h2H2,1H3 |
| InChIKey | RRUZNUBGRZKRNR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-methyloxirane?
The IUPAC name of 2-chloro-2-methyloxirane (CID 15120421) is 2-chloro-2-methyloxirane.
What is the SMILES notation for 2-chloro-2-methyloxirane?
The canonical SMILES for 2-chloro-2-methyloxirane is CC1(Cl)CO1.
What is the InChIKey of 2-chloro-2-methyloxirane?
The InChIKey is RRUZNUBGRZKRNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO/c1-3(4)2-5-3/h2H2,1H3.
What are the key properties of 2-chloro-2-methyloxirane?
2-chloro-2-methyloxirane has a molecular weight of 92.53 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-methyloxirane is sourced from PubChem (CID 15120421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).