C26H36N2O2 — CID 151204534
(1S,2R)-2-[8-[[(1S,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]octoxy]-2,3-dihydro-1H-inden-1-amine (PubChem CID 151204534) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is (1S,2R)-2-[8-[[(1S,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]octoxy]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,2R)-2-[8-[[(1S,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]octoxy]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 151204534 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (1S,2R)-2-[8-[[(1S,2R)-1-amino-2,3-dihydro-1H-inden-2-yl]oxy]octoxy]-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@H]1c2ccccc2C[C@H]1OCCCCCCCCO[C@@H]1Cc2ccccc2[C@@H]1N |
| InChI | InChI=1S/C26H36N2O2/c27-25-21-13-7-5-11-19(21)17-23(25)29-15-9-3-1-2-4-10-16-30-24-18-20-12-6-8-14-22(20)26(24)28/h5-8,11-14,23-26H,1-4,9-10,15-18,27-28H2/t23-,24-,25+,26+/m1/s1 |
| InChIKey | NIZRUFIOILYAIM-XPGKHFPBSA-N |
| XLogP | 4.61 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|