About (E)-N'-acetylbut-2-enehydrazide
(E)-N'-acetylbut-2-enehydrazide (PubChem CID 15120470) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is (E)-N'-acetylbut-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-N'-acetylbut-2-enehydrazide |
| PubChem CID | 15120470 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (E)-N'-acetylbut-2-enehydrazide |
| SMILES | C/C=C/C(=O)NNC(C)=O |
| InChI | InChI=1S/C6H10N2O2/c1-3-4-6(10)8-7-5(2)9/h3-4H,1-2H3,(H,7,9)(H,8,10)/b4-3+ |
| InChIKey | CXIFOPJJOSORBJ-ONEGZZNKSA-N |
| XLogP | -0.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-acetylbut-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-acetylbut-2-enehydrazide?
The IUPAC name of (E)-N'-acetylbut-2-enehydrazide (CID 15120470) is (E)-N'-acetylbut-2-enehydrazide.
What is the SMILES notation for (E)-N'-acetylbut-2-enehydrazide?
The canonical SMILES for (E)-N'-acetylbut-2-enehydrazide is C/C=C/C(=O)NNC(C)=O.
What is the InChIKey of (E)-N'-acetylbut-2-enehydrazide?
The InChIKey is CXIFOPJJOSORBJ-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-3-4-6(10)8-7-5(2)9/h3-4H,1-2H3,(H,7,9)(H,8,10)/b4-3+.
What are the key properties of (E)-N'-acetylbut-2-enehydrazide?
(E)-N'-acetylbut-2-enehydrazide has a molecular weight of 142.16 g/mol, XLogP of -0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-acetylbut-2-enehydrazide is sourced from PubChem (CID 15120470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).