About [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate
[5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate (PubChem CID 151205304) has the molecular formula C20H23BrClNO2
and a molecular weight of 424.77 g/mol. Its IUPAC name is [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate.
Molecular Properties
| Compound Name | [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate |
| PubChem CID | 151205304 |
| Molecular Formula | C20H23BrClNO2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate |
| SMILES | CC(CC(c1ccc(Cl)cc1)c1ccc(Br)cc1)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C20H23BrClNO2/c1-13(20(2,3)25-19(23)24)12-18(14-4-8-16(21)9-5-14)15-6-10-17(22)11-7-15/h4-11,13,18H,12H2,1-3H3,(H2,23,24) |
| InChIKey | NJDPBNNUCAOXRX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate?
The IUPAC name of [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate (CID 151205304) is [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate.
What is the SMILES notation for [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate?
The canonical SMILES for [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate is CC(CC(c1ccc(Cl)cc1)c1ccc(Br)cc1)C(C)(C)OC(N)=O.
What is the InChIKey of [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate?
The InChIKey is NJDPBNNUCAOXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BrClNO2/c1-13(20(2,3)25-19(23)24)12-18(14-4-8-16(21)9-5-14)15-6-10-17(22)11-7-15/h4-11,13,18H,12H2,1-3H3,(H2,23,24).
What are the key properties of [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate?
[5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate has a molecular weight of 424.77 g/mol, XLogP of 6.13, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-bromophenyl)-5-(4-chlorophenyl)-2,3-dimethylpentan-2-yl] carbamate is sourced from PubChem (CID 151205304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).