About (E)-1-bromo-1,2-dichloroethene
(E)-1-bromo-1,2-dichloroethene (PubChem CID 15120764) has the molecular formula C2HBrCl2
and a molecular weight of 175.84 g/mol. Its IUPAC name is (E)-1-bromo-1,2-dichloroethene.
Molecular Properties
| Compound Name | (E)-1-bromo-1,2-dichloroethene |
| PubChem CID | 15120764 |
| Molecular Formula | C2HBrCl2 |
| Molecular Weight | 175.84 g/mol |
| Exact Mass | 173.86 |
| IUPAC Name | (E)-1-bromo-1,2-dichloroethene |
| SMILES | Cl/C=C(\Cl)Br |
| InChI | InChI=1S/C2HBrCl2/c3-2(5)1-4/h1H/b2-1- |
| InChIKey | RXIALFZUTHFURS-UPHRSURJSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.84 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (E)-1-bromo-1,2-dichloroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-bromo-1,2-dichloroethene?
The IUPAC name of (E)-1-bromo-1,2-dichloroethene (CID 15120764) is (E)-1-bromo-1,2-dichloroethene.
What is the SMILES notation for (E)-1-bromo-1,2-dichloroethene?
The canonical SMILES for (E)-1-bromo-1,2-dichloroethene is Cl/C=C(\Cl)Br.
What is the InChIKey of (E)-1-bromo-1,2-dichloroethene?
The InChIKey is RXIALFZUTHFURS-UPHRSURJSA-N. The full InChI is InChI=1S/C2HBrCl2/c3-2(5)1-4/h1H/b2-1-.
What are the key properties of (E)-1-bromo-1,2-dichloroethene?
(E)-1-bromo-1,2-dichloroethene has a molecular weight of 175.84 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-bromo-1,2-dichloroethene is sourced from PubChem (CID 15120764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).