C11H11N3O — CID 151207873
4-(1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 151207873) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-(1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 4-(1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 151207873 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 4-(1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC1CCc2c(-c3ncon3)cccc21 |
| InChI | InChI=1S/C11H11N3O/c12-10-5-4-7-8(10)2-1-3-9(7)11-13-6-15-14-11/h1-3,6,10H,4-5,12H2 |
| InChIKey | NJQRPPTVGAOUDX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |