About 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane
4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 151208021) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane |
| PubChem CID | 151208021 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | C#Cc1ccc(C2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C13H14O2/c1-4-10-5-7-11(8-6-10)12-9-14-13(2,3)15-12/h1,5-8,12H,9H2,2-3H3 |
| InChIKey | NJRKSRFYHMIZJI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane?
The IUPAC name of 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane (CID 151208021) is 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane.
What is the SMILES notation for 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane?
The canonical SMILES for 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane is C#Cc1ccc(C2COC(C)(C)O2)cc1.
What is the InChIKey of 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane?
The InChIKey is NJRKSRFYHMIZJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-4-10-5-7-11(8-6-10)12-9-14-13(2,3)15-12/h1,5-8,12H,9H2,2-3H3.
What are the key properties of 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane?
4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane has a molecular weight of 202.25 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethynylphenyl)-2,2-dimethyl-1,3-dioxolane is sourced from PubChem (CID 151208021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).