C21H26BrNO7 — CID 151208148
2-(5-bromopyridine-3-carbonyl)-2-[2-(cyclohexylmethoxy)acetyl]hexanedioic acid (PubChem CID 151208148) has the molecular formula C21H26BrNO7 and a molecular weight of 484.34 g/mol. Its IUPAC name is 2-(5-bromopyridine-3-carbonyl)-2-[2-(cyclohexylmethoxy)acetyl]hexanedioic acid.
| Compound Name | 2-(5-bromopyridine-3-carbonyl)-2-[2-(cyclohexylmethoxy)acetyl]hexanedioic acid |
|---|---|
| PubChem CID | 151208148 |
| Molecular Formula | C21H26BrNO7 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 2-(5-bromopyridine-3-carbonyl)-2-[2-(cyclohexylmethoxy)acetyl]hexanedioic acid |
| SMILES | O=C(O)CCCC(C(=O)O)(C(=O)COCC1CCCCC1)C(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C21H26BrNO7/c22-16-9-15(10-23-11-16)19(27)21(20(28)29,8-4-7-18(25)26)17(24)13-30-12-14-5-2-1-3-6-14/h9-11,14H,1-8,12-13H2,(H,25,26)(H,28,29) |
| InChIKey | NJSFGOSXRTXPPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|