About [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate
[3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate (PubChem CID 151209330) has the molecular formula C10H14Cl3NO5
and a molecular weight of 334.58 g/mol. Its IUPAC name is [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate.
Molecular Properties
| Compound Name | [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate |
| PubChem CID | 151209330 |
| Molecular Formula | C10H14Cl3NO5 |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate |
| SMILES | CC(=O)OC1NCC1C(C)OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl3NO5/c1-5(7-3-14-8(7)19-6(2)15)18-9(16)17-4-10(11,12)13/h5,7-8,14H,3-4H2,1-2H3 |
| InChIKey | NJYFTIIVGLYJMF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate?
The IUPAC name of [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate (CID 151209330) is [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate.
What is the SMILES notation for [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate?
The canonical SMILES for [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate is CC(=O)OC1NCC1C(C)OC(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate?
The InChIKey is NJYFTIIVGLYJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl3NO5/c1-5(7-3-14-8(7)19-6(2)15)18-9(16)17-4-10(11,12)13/h5,7-8,14H,3-4H2,1-2H3.
What are the key properties of [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate?
[3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate has a molecular weight of 334.58 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]azetidin-2-yl] acetate is sourced from PubChem (CID 151209330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).