C10H18O2S — CID 15121006
(2S,5R)-2,5-dimethoxy-2,3,4,5-tetramethylthiophene (PubChem CID 15121006) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethoxy-2,3,4,5-tetramethylthiophene.
| Compound Name | (2S,5R)-2,5-dimethoxy-2,3,4,5-tetramethylthiophene |
|---|---|
| PubChem CID | 15121006 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2S,5R)-2,5-dimethoxy-2,3,4,5-tetramethylthiophene |
| SMILES | CO[C@@]1(C)S[C@@](C)(OC)C(C)=C1C |
| InChI | InChI=1S/C10H18O2S/c1-7-8(2)10(4,12-6)13-9(7,3)11-5/h1-6H3/t9-,10+ |
| InChIKey | TZBIQFJUBCRRIM-AOOOYVTPSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|