C28H36FN3O2 — CID 15121348
8-[4-(4-fluorophenyl)-4-oxobutyl]-3-pentyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 15121348) has the molecular formula C28H36FN3O2 and a molecular weight of 465.61 g/mol. Its IUPAC name is 8-[4-(4-fluorophenyl)-4-oxobutyl]-3-pentyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[4-(4-fluorophenyl)-4-oxobutyl]-3-pentyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 15121348 |
| Molecular Formula | C28H36FN3O2 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 8-[4-(4-fluorophenyl)-4-oxobutyl]-3-pentyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCCCCN1CN(c2ccccc2)C2(CCN(CCCC(=O)c3ccc(F)cc3)CC2)C1=O |
| InChI | InChI=1S/C28H36FN3O2/c1-2-3-7-19-31-22-32(25-9-5-4-6-10-25)28(27(31)34)16-20-30(21-17-28)18-8-11-26(33)23-12-14-24(29)15-13-23/h4-6,9-10,12-15H,2-3,7-8,11,16-22H2,1H3 |
| InChIKey | DGNKTCJDFITHNL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|