C22H26N6O2 — CID 151219572
N'-(1-methylcyclopentyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]pyrazine-2-carboximidamide (PubChem CID 151219572) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N'-(1-methylcyclopentyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]pyrazine-2-carboximidamide.
| Compound Name | N'-(1-methylcyclopentyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 151219572 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N'-(1-methylcyclopentyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]pyrazine-2-carboximidamide |
| SMILES | Cc1ccc(-c2noc(C)c2COc2cnc(/C(N)=N/C3(C)CCCC3)cn2)cn1 |
| InChI | InChI=1S/C22H26N6O2/c1-14-6-7-16(10-24-14)20-17(15(2)30-28-20)13-29-19-12-25-18(11-26-19)21(23)27-22(3)8-4-5-9-22/h6-7,10-12H,4-5,8-9,13H2,1-3H3,(H2,23,27) |
| InChIKey | NLZLXIJAGDNGFN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|