About trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane
trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane (PubChem CID 15121963) has the molecular formula C10H18Si2Te
and a molecular weight of 322.03 g/mol. Its IUPAC name is trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane |
| PubChem CID | 15121963 |
| Molecular Formula | C10H18Si2Te |
| Molecular Weight | 322.03 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#C[Te]C#C[Si](C)(C)C |
| InChI | InChI=1S/C10H18Si2Te/c1-11(2,3)7-9-13-10-8-12(4,5)6/h1-6H3 |
| InChIKey | AEFDZDINSKSKLT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.03 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane?
The IUPAC name of trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane (CID 15121963) is trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane.
What is the SMILES notation for trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane?
The canonical SMILES for trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane is C[Si](C)(C)C#C[Te]C#C[Si](C)(C)C.
What is the InChIKey of trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane?
The InChIKey is AEFDZDINSKSKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Si2Te/c1-11(2,3)7-9-13-10-8-12(4,5)6/h1-6H3.
What are the key properties of trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane?
trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane has a molecular weight of 322.03 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-(2-trimethylsilylethynyltellanyl)ethynyl]silane is sourced from PubChem (CID 15121963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).