C33H35Cl3N2O2 — CID 151220358
(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-chloro-2-(2,2,6,6-tetramethyloxan-4-yl)oxyphenyl]spiro[indole-3,3'-piperidine] (PubChem CID 151220358) has the molecular formula C33H35Cl3N2O2 and a molecular weight of 598.01 g/mol. Its IUPAC name is (2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-chloro-2-(2,2,6,6-tetramethyloxan-4-yl)oxyphenyl]spiro[indole-3,3'-piperidine].
| Compound Name | (2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-chloro-2-(2,2,6,6-tetramethyloxan-4-yl)oxyphenyl]spiro[indole-3,3'-piperidine] |
|---|---|
| PubChem CID | 151220358 |
| Molecular Formula | C33H35Cl3N2O2 |
| Molecular Weight | 598.01 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | (2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2'-[5-chloro-2-(2,2,6,6-tetramethyloxan-4-yl)oxyphenyl]spiro[indole-3,3'-piperidine] |
| SMILES | CC1(C)CC(Oc2ccc(Cl)cc2[C@@H]2NCC[C@@H](c3cccc(Cl)c3)[C@]23C=Nc2cc(Cl)ccc23)CC(C)(C)O1 |
| InChI | InChI=1S/C33H35Cl3N2O2/c1-31(2)17-24(18-32(3,4)40-31)39-29-11-9-22(35)15-25(29)30-33(19-38-28-16-23(36)8-10-27(28)33)26(12-13-37-30)20-6-5-7-21(34)14-20/h5-11,14-16,19,24,26,30,37H,12-13,17-18H2,1-4H3/t26-,30-,33-/m0/s1 |
| InChIKey | NMDQDVRKEXSZAD-ZMAXYJRFSA-N |
| XLogP | 9.23 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.01 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |