C9H8F3N3O — CID 151221281
1-(trifluoromethyl)-3,4-dihydro-2H-pyrido[2,3-e][1,4]diazepin-5-one (PubChem CID 151221281) has the molecular formula C9H8F3N3O and a molecular weight of 231.18 g/mol. Its IUPAC name is 1-(trifluoromethyl)-3,4-dihydro-2H-pyrido[2,3-e][1,4]diazepin-5-one.
| Compound Name | 1-(trifluoromethyl)-3,4-dihydro-2H-pyrido[2,3-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 151221281 |
| Molecular Formula | C9H8F3N3O |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-(trifluoromethyl)-3,4-dihydro-2H-pyrido[2,3-e][1,4]diazepin-5-one |
| SMILES | O=C1NCCN(C(F)(F)F)c2ncccc21 |
| InChI | InChI=1S/C9H8F3N3O/c10-9(11,12)15-5-4-14-8(16)6-2-1-3-13-7(6)15/h1-3H,4-5H2,(H,14,16) |
| InChIKey | NMILEISFTFEWNV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|